C22H24ClN3O3 — CID 143882055
[(3R)-1-(3-chloro-4-cyanophenyl)pyrrolidin-3-yl] formate;4-(1-methoxyethenyl)-N-methylaniline (PubChem CID 143882055) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is [(3R)-1-(3-chloro-4-cyanophenyl)pyrrolidin-3-yl] formate;4-(1-methoxyethenyl)-N-methylaniline.
| Compound Name | [(3R)-1-(3-chloro-4-cyanophenyl)pyrrolidin-3-yl] formate;4-(1-methoxyethenyl)-N-methylaniline |
|---|---|
| PubChem CID | 143882055 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [(3R)-1-(3-chloro-4-cyanophenyl)pyrrolidin-3-yl] formate;4-(1-methoxyethenyl)-N-methylaniline |
| SMILES | C=C(OC)c1ccc(NC)cc1.N#Cc1ccc(N2CC[C@@H](OC=O)C2)cc1Cl |
| InChI | InChI=1S/C12H11ClN2O2.C10H13NO/c13-12-5-10(2-1-9(12)6-14)15-4-3-11(7-15)17-8-16;1-8(12-3)9-4-6-10(11-2)7-5-9/h1-2,5,8,11H,3-4,7H2;4-7,11H,1H2,2-3H3/t11-;/m1./s1 |
| InChIKey | LNTHDFYZDCVMCL-RFVHGSKJSA-N |
| XLogP | 4.31 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|