C12H18N2 — CID 143882550
N-[(Z)-but-1-enyl]-1-(3,4-dihydropyridin-5-yl)propan-1-imine (PubChem CID 143882550) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N-[(Z)-but-1-enyl]-1-(3,4-dihydropyridin-5-yl)propan-1-imine.
| Compound Name | N-[(Z)-but-1-enyl]-1-(3,4-dihydropyridin-5-yl)propan-1-imine |
|---|---|
| PubChem CID | 143882550 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N-[(Z)-but-1-enyl]-1-(3,4-dihydropyridin-5-yl)propan-1-imine |
| SMILES | CC/C=C\N=C(/CC)C1=CN=CCC1 |
| InChI | InChI=1S/C12H18N2/c1-3-5-9-14-12(4-2)11-7-6-8-13-10-11/h5,8-10H,3-4,6-7H2,1-2H3/b9-5-,14-12+ |
| InChIKey | POCZNXDRFLZLFK-URGDIRINSA-N |
| XLogP | 3.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|