C30H39N3O6 — CID 143884052
2-[(6R,8Z,11R)-11-amino-3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide (PubChem CID 143884052) has the molecular formula C30H39N3O6 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[(6R,8Z,11R)-11-amino-3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide.
| Compound Name | 2-[(6R,8Z,11R)-11-amino-3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 143884052 |
| Molecular Formula | C30H39N3O6 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 2-[(6R,8Z,11R)-11-amino-3,3-dimethyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide |
| SMILES | CC1(C)COC(=O)[C@H](N)C/C=C\C[C@H](CC(=O)NC(CO)Cc2ccc(OCc3ccccc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C30H39N3O6/c1-30(2)20-39-29(37)26(31)11-7-6-10-23(28(36)33-30)17-27(35)32-24(18-34)16-21-12-14-25(15-13-21)38-19-22-8-4-3-5-9-22/h3-9,12-15,23-24,26,34H,10-11,16-20,31H2,1-2H3,(H,32,35)(H,33,36)/b7-6-/t23-,24?,26-/m1/s1 |
| InChIKey | IPKGSJHYAMPQST-QWXRNPCPSA-N |
| XLogP | 2.41 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|