C35H40N2O6 — CID 4559385
2-(11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide (PubChem CID 4559385) has the molecular formula C35H40N2O6 and a molecular weight of 584.71 g/mol. Its IUPAC name is 2-(11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide.
| Compound Name | 2-(11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 4559385 |
| Molecular Formula | C35H40N2O6 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 2-(11-benzyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl)-N-[1-hydroxy-3-(4-phenylmethoxyphenyl)propan-2-yl]acetamide |
| SMILES | O=C(CC1CC=CCC(Cc2ccccc2)C(=O)OCCNC1=O)NC(CO)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H40N2O6/c38-24-31(22-27-15-17-32(18-16-27)43-25-28-11-5-2-6-12-28)37-33(39)23-29-13-7-8-14-30(21-26-9-3-1-4-10-26)35(41)42-20-19-36-34(29)40/h1-12,15-18,29-31,38H,13-14,19-25H2,(H,36,40)(H,37,39) |
| InChIKey | NDLZZSDAADGCRS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|