C23H32N2O5 — CID 4078725
2-(5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide (PubChem CID 4078725) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-(5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide.
| Compound Name | 2-(5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 4078725 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-(5,14-dioxo-1-oxa-4-azacyclotetradec-8-en-6-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide |
| SMILES | O=C(CC1CC=CCCCCC(=O)OCCNC1=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O5/c26-17-20(15-18-9-5-4-6-10-18)25-21(27)16-19-11-7-2-1-3-8-12-22(28)30-14-13-24-23(19)29/h2,4-7,9-10,19-20,26H,1,3,8,11-17H2,(H,24,29)(H,25,27) |
| InChIKey | VYYCHAFJIXRGDK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|