C27H38N2O5 — CID 3658698
2-(7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide (PubChem CID 3658698) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-(7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide.
| Compound Name | 2-(7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 3658698 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 2-(7,16-dioxo-17-oxa-6-azaspiro[4.13]octadec-10-en-8-yl)-N-(1-hydroxy-3-phenylpropan-2-yl)acetamide |
| SMILES | O=C(CC1CC=CCCCCC(=O)OCC2(CCCC2)NC1=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C27H38N2O5/c30-19-23(17-21-11-5-4-6-12-21)28-24(31)18-22-13-7-2-1-3-8-14-25(32)34-20-27(29-26(22)33)15-9-10-16-27/h2,4-7,11-12,22-23,30H,1,3,8-10,13-20H2,(H,28,31)(H,29,33) |
| InChIKey | SMKMWBSUISMCNU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|