C22H30N2O5 — CID 6608160
N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-[(2S,6R)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide (PubChem CID 6608160) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-[(2S,6R)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide.
| Compound Name | N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-[(2S,6R)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
|---|---|
| PubChem CID | 6608160 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-2-[(2S,6R)-2-methyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]acetamide |
| SMILES | C[C@H]1CNC(=O)[C@@H](CC(=O)N[C@@H](CO)Cc2ccccc2)CC=CCCC(=O)O1 |
| InChI | InChI=1S/C22H30N2O5/c1-16-14-23-22(28)18(10-6-3-7-11-21(27)29-16)13-20(26)24-19(15-25)12-17-8-4-2-5-9-17/h2-6,8-9,16,18-19,25H,7,10-15H2,1H3,(H,23,28)(H,24,26)/t16-,18+,19+/m0/s1 |
| InChIKey | WHDPKWXDWVGAOO-QXAKKESOSA-N |
| XLogP | 1.50 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|