C24H30FNO3S — CID 143885351
[2-[[2-(3-aminobenzoyl)-4-fluorophenyl]sulfanylmethyl]-2-ethylhexyl] acetate (PubChem CID 143885351) has the molecular formula C24H30FNO3S and a molecular weight of 431.57 g/mol. Its IUPAC name is [2-[[2-(3-aminobenzoyl)-4-fluorophenyl]sulfanylmethyl]-2-ethylhexyl] acetate.
| Compound Name | [2-[[2-(3-aminobenzoyl)-4-fluorophenyl]sulfanylmethyl]-2-ethylhexyl] acetate |
|---|---|
| PubChem CID | 143885351 |
| Molecular Formula | C24H30FNO3S |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | [2-[[2-(3-aminobenzoyl)-4-fluorophenyl]sulfanylmethyl]-2-ethylhexyl] acetate |
| SMILES | CCCCC(CC)(COC(C)=O)CSc1ccc(F)cc1C(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C24H30FNO3S/c1-4-6-12-24(5-2,15-29-17(3)27)16-30-22-11-10-19(25)14-21(22)23(28)18-8-7-9-20(26)13-18/h7-11,13-14H,4-6,12,15-16,26H2,1-3H3 |
| InChIKey | SSYUZSKBXSMGIG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|