C19H37NO2 — CID 143885395
(4-hydroxypiperidin-1-yl)-(4-methylcyclohexyl)methanone;2-methylpentane (PubChem CID 143885395) has the molecular formula C19H37NO2 and a molecular weight of 311.51 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-(4-methylcyclohexyl)methanone;2-methylpentane.
| Compound Name | (4-hydroxypiperidin-1-yl)-(4-methylcyclohexyl)methanone;2-methylpentane |
|---|---|
| PubChem CID | 143885395 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-(4-methylcyclohexyl)methanone;2-methylpentane |
| SMILES | CC1CCC(C(=O)N2CCC(O)CC2)CC1.CCCC(C)C |
| InChI | InChI=1S/C13H23NO2.C6H14/c1-10-2-4-11(5-3-10)13(16)14-8-6-12(15)7-9-14;1-4-5-6(2)3/h10-12,15H,2-9H2,1H3;6H,4-5H2,1-3H3 |
| InChIKey | NDXYHZYDKYKUQB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |