C22H20N2S4 — CID 143885804
ethyl 5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carbodithioate (PubChem CID 143885804) has the molecular formula C22H20N2S4 and a molecular weight of 440.68 g/mol. Its IUPAC name is ethyl 5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carbodithioate.
| Compound Name | ethyl 5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carbodithioate |
|---|---|
| PubChem CID | 143885804 |
| Molecular Formula | C22H20N2S4 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | ethyl 5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carbodithioate |
| SMILES | C=CCSC1=C(C#N)C(c2cccs2)C(C(=S)SCC)=C(c2ccccc2)N1 |
| InChI | InChI=1S/C22H20N2S4/c1-3-12-28-21-16(14-23)18(17-11-8-13-27-17)19(22(25)26-4-2)20(24-21)15-9-6-5-7-10-15/h3,5-11,13,18,24H,1,4,12H2,2H3 |
| InChIKey | HBLHOWSAGUCMSM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|