C22H20N2O2S2 — CID 28869147
ethyl (4R)-5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate (PubChem CID 28869147) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is ethyl (4R)-5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl (4R)-5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 28869147 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | ethyl (4R)-5-cyano-2-phenyl-6-prop-2-enylsulfanyl-4-thiophen-2-yl-1,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCSC1=C(C#N)[C@H](c2cccs2)C(C(=O)OCC)=C(c2ccccc2)N1 |
| InChI | InChI=1S/C22H20N2O2S2/c1-3-12-28-21-16(14-23)18(17-11-8-13-27-17)19(22(25)26-4-2)20(24-21)15-9-6-5-7-10-15/h3,5-11,13,18,24H,1,4,12H2,2H3/t18-/m1/s1 |
| InChIKey | NCCZVLJCSBHVTE-GOSISDBHSA-N |
| XLogP | 5.06 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|