C24H32N4O2 — CID 143888300
1-aminoethyl (E)-5-[3-[5,6-bis(ethenyl)-3-methoxypyrazin-2-yl]phenyl]pent-4-enimidate;ethane (PubChem CID 143888300) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-aminoethyl (E)-5-[3-[5,6-bis(ethenyl)-3-methoxypyrazin-2-yl]phenyl]pent-4-enimidate;ethane.
| Compound Name | 1-aminoethyl (E)-5-[3-[5,6-bis(ethenyl)-3-methoxypyrazin-2-yl]phenyl]pent-4-enimidate;ethane |
|---|---|
| PubChem CID | 143888300 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 1-aminoethyl (E)-5-[3-[5,6-bis(ethenyl)-3-methoxypyrazin-2-yl]phenyl]pent-4-enimidate;ethane |
| SMILES | CC.[H]/N=C(/CC/C=C/c1cccc(-c2nc(C=C)c(C=C)nc2OC)c1)OC(C)N |
| InChI | InChI=1S/C22H26N4O2.C2H6/c1-5-18-19(6-2)26-22(27-4)21(25-18)17-12-9-11-16(14-17)10-7-8-13-20(24)28-15(3)23;1-2/h5-7,9-12,14-15,24H,1-2,8,13,23H2,3-4H3;1-2H3/b10-7+,24-20-; |
| InChIKey | HVHLVOUXONTRNS-ZZXZRUEFSA-N |
| XLogP | 5.56 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|