C22H33BrN2O2 — CID 143888439
N-[[3-bromo-5-(3-ethoxypropyl)-4-methylphenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide (PubChem CID 143888439) has the molecular formula C22H33BrN2O2 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-[[3-bromo-5-(3-ethoxypropyl)-4-methylphenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide.
| Compound Name | N-[[3-bromo-5-(3-ethoxypropyl)-4-methylphenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 143888439 |
| Molecular Formula | C22H33BrN2O2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[[3-bromo-5-(3-ethoxypropyl)-4-methylphenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide |
| SMILES | CCOCCCc1cc(CN(C(=O)C2CCCNC2)C2CC2)cc(Br)c1C |
| InChI | InChI=1S/C22H33BrN2O2/c1-3-27-11-5-7-18-12-17(13-21(23)16(18)2)15-25(20-8-9-20)22(26)19-6-4-10-24-14-19/h12-13,19-20,24H,3-11,14-15H2,1-2H3 |
| InChIKey | LFKDNVKPZRVGNB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|