C23H30N2O2 — CID 70952975
(3R)-N-cyclopropyl-N-[[3-(2-methoxyethyl)naphthalen-1-yl]methyl]piperidine-3-carboxamide (PubChem CID 70952975) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (3R)-N-cyclopropyl-N-[[3-(2-methoxyethyl)naphthalen-1-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclopropyl-N-[[3-(2-methoxyethyl)naphthalen-1-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 70952975 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (3R)-N-cyclopropyl-N-[[3-(2-methoxyethyl)naphthalen-1-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCc1cc(CN(C(=O)[C@@H]2CCCNC2)C2CC2)c2ccccc2c1 |
| InChI | InChI=1S/C23H30N2O2/c1-27-12-10-17-13-18-5-2-3-7-22(18)20(14-17)16-25(21-8-9-21)23(26)19-6-4-11-24-15-19/h2-3,5,7,13-14,19,21,24H,4,6,8-12,15-16H2,1H3/t19-/m1/s1 |
| InChIKey | DWNWQMLGPXYTJB-LJQANCHMSA-N |
| XLogP | 3.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |