C26H35F2N3O3 — CID 143888521
N-cyclopropyl-N-[[2,3-difluoro-5-(3-methoxypropyl)phenyl]methyl]piperidine-3-carboxamide;1-methylpyridin-2-one (PubChem CID 143888521) has the molecular formula C26H35F2N3O3 and a molecular weight of 475.58 g/mol. Its IUPAC name is N-cyclopropyl-N-[[2,3-difluoro-5-(3-methoxypropyl)phenyl]methyl]piperidine-3-carboxamide;1-methylpyridin-2-one.
| Compound Name | N-cyclopropyl-N-[[2,3-difluoro-5-(3-methoxypropyl)phenyl]methyl]piperidine-3-carboxamide;1-methylpyridin-2-one |
|---|---|
| PubChem CID | 143888521 |
| Molecular Formula | C26H35F2N3O3 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | N-cyclopropyl-N-[[2,3-difluoro-5-(3-methoxypropyl)phenyl]methyl]piperidine-3-carboxamide;1-methylpyridin-2-one |
| SMILES | COCCCc1cc(F)c(F)c(CN(C(=O)C2CCCNC2)C2CC2)c1.Cn1ccccc1=O |
| InChI | InChI=1S/C20H28F2N2O2.C6H7NO/c1-26-9-3-4-14-10-16(19(22)18(21)11-14)13-24(17-6-7-17)20(25)15-5-2-8-23-12-15;1-7-5-3-2-4-6(7)8/h10-11,15,17,23H,2-9,12-13H2,1H3;2-5H,1H3 |
| InChIKey | QFGQGSOKKGNSMX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|