C25H42F2O3 — CID 143889328
2-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]-5-(4-pentylcyclohexyl)oxane (PubChem CID 143889328) has the molecular formula C25H42F2O3 and a molecular weight of 428.60 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]-5-(4-pentylcyclohexyl)oxane.
| Compound Name | 2-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]-5-(4-pentylcyclohexyl)oxane |
|---|---|
| PubChem CID | 143889328 |
| Molecular Formula | C25H42F2O3 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 2-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]-5-(4-pentylcyclohexyl)oxane |
| SMILES | CCCCCC1CCC(C2CCC(OC/C(CC)=C(F)/C(F)=C(\C)OC)OC2)CC1 |
| InChI | InChI=1S/C25H42F2O3/c1-5-7-8-9-19-10-12-21(13-11-19)22-14-15-23(30-17-22)29-16-20(6-2)25(27)24(26)18(3)28-4/h19,21-23H,5-17H2,1-4H3/b24-18-,25-20- |
| InChIKey | OUQZOSJWTZBFKT-FEAWKMQESA-N |
| XLogP | 7.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|