C21H34F2O3 — CID 143889724
5-[4-[[(2Z,4Z)-3,4-difluoro-5-methoxyhexa-2,4-dien-2-yl]oxymethyl]cyclohexyl]-2-ethyloxane (PubChem CID 143889724) has the molecular formula C21H34F2O3 and a molecular weight of 372.50 g/mol. Its IUPAC name is 5-[4-[[(2Z,4Z)-3,4-difluoro-5-methoxyhexa-2,4-dien-2-yl]oxymethyl]cyclohexyl]-2-ethyloxane.
| Compound Name | 5-[4-[[(2Z,4Z)-3,4-difluoro-5-methoxyhexa-2,4-dien-2-yl]oxymethyl]cyclohexyl]-2-ethyloxane |
|---|---|
| PubChem CID | 143889724 |
| Molecular Formula | C21H34F2O3 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 5-[4-[[(2Z,4Z)-3,4-difluoro-5-methoxyhexa-2,4-dien-2-yl]oxymethyl]cyclohexyl]-2-ethyloxane |
| SMILES | CCC1CCC(C2CCC(CO/C(C)=C(F)/C(F)=C(\C)OC)CC2)CO1 |
| InChI | InChI=1S/C21H34F2O3/c1-5-19-11-10-18(13-26-19)17-8-6-16(7-9-17)12-25-15(3)21(23)20(22)14(2)24-4/h16-19H,5-13H2,1-4H3/b20-14-,21-15- |
| InChIKey | GRLRFSUQJLHQSO-SIBCGJTDSA-N |
| XLogP | 6.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|