C24H42F2O3 — CID 143889332
5-[4-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]cyclohexyl]-2-ethyloxane;ethane (PubChem CID 143889332) has the molecular formula C24H42F2O3 and a molecular weight of 416.59 g/mol. Its IUPAC name is 5-[4-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]cyclohexyl]-2-ethyloxane;ethane.
| Compound Name | 5-[4-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]cyclohexyl]-2-ethyloxane;ethane |
|---|---|
| PubChem CID | 143889332 |
| Molecular Formula | C24H42F2O3 |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 5-[4-[[(3Z,5Z)-4,5-difluoro-6-methoxyhepta-3,5-dien-3-yl]oxymethyl]cyclohexyl]-2-ethyloxane;ethane |
| SMILES | CC.CC/C(OCC1CCC(C2CCC(CC)OC2)CC1)=C(F)\C(F)=C(/C)OC |
| InChI | InChI=1S/C22H36F2O3.C2H6/c1-5-19-12-11-18(14-26-19)17-9-7-16(8-10-17)13-27-20(6-2)22(24)21(23)15(3)25-4;1-2/h16-19H,5-14H2,1-4H3;1-2H3/b21-15-,22-20-; |
| InChIKey | ADLJCUZYHOHPIJ-JNFYEZRJSA-N |
| XLogP | 7.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|