C25H40F2O2 — CID 145009712
1-[[(2Z,4Z)-3,4-difluoro-5-propoxyhexa-2,4-dien-2-yl]oxymethyl]-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane (PubChem CID 145009712) has the molecular formula C25H40F2O2 and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-[[(2Z,4Z)-3,4-difluoro-5-propoxyhexa-2,4-dien-2-yl]oxymethyl]-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane.
| Compound Name | 1-[[(2Z,4Z)-3,4-difluoro-5-propoxyhexa-2,4-dien-2-yl]oxymethyl]-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 145009712 |
| Molecular Formula | C25H40F2O2 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 1-[[(2Z,4Z)-3,4-difluoro-5-propoxyhexa-2,4-dien-2-yl]oxymethyl]-4-[4-[(E)-prop-1-enyl]cyclohexyl]cyclohexane |
| SMILES | C/C=C/C1CCC(C2CCC(CO/C(C)=C(F)/C(F)=C(\C)OCCC)CC2)CC1 |
| InChI | InChI=1S/C25H40F2O2/c1-5-7-20-8-12-22(13-9-20)23-14-10-21(11-15-23)17-29-19(4)25(27)24(26)18(3)28-16-6-2/h5,7,20-23H,6,8-17H2,1-4H3/b7-5+,24-18-,25-19- |
| InChIKey | VETTZKXZOUSPNS-IMPSBMQMSA-N |
| XLogP | 8.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|