C20H34O — CID 67898606
1-(but-1-enoxymethyl)-4-(4-prop-1-enylcyclohexyl)cyclohexane (PubChem CID 67898606) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 1-(but-1-enoxymethyl)-4-(4-prop-1-enylcyclohexyl)cyclohexane.
| Compound Name | 1-(but-1-enoxymethyl)-4-(4-prop-1-enylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 67898606 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 1-(but-1-enoxymethyl)-4-(4-prop-1-enylcyclohexyl)cyclohexane |
| SMILES | CC=CC1CCC(C2CCC(COC=CCC)CC2)CC1 |
| InChI | InChI=1S/C20H34O/c1-3-5-15-21-16-18-9-13-20(14-10-18)19-11-7-17(6-4-2)8-12-19/h4-6,15,17-20H,3,7-14,16H2,1-2H3 |
| InChIKey | MGNMTJSRZARQGR-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|