C21H36O — CID 67898747
1-(but-1-enoxymethyl)-4-(4-but-1-enylcyclohexyl)cyclohexane (PubChem CID 67898747) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-(but-1-enoxymethyl)-4-(4-but-1-enylcyclohexyl)cyclohexane.
| Compound Name | 1-(but-1-enoxymethyl)-4-(4-but-1-enylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 67898747 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 1-(but-1-enoxymethyl)-4-(4-but-1-enylcyclohexyl)cyclohexane |
| SMILES | CCC=COCC1CCC(C2CCC(C=CCC)CC2)CC1 |
| InChI | InChI=1S/C21H36O/c1-3-5-7-18-8-12-20(13-9-18)21-14-10-19(11-15-21)17-22-16-6-4-2/h5-7,16,18-21H,3-4,8-15,17H2,1-2H3 |
| InChIKey | WKYBDVWNNSNNNG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|