C26H38F2O3 — CID 143889490
5-[4-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)oxymethyl]phenyl]-2-pentyloxane;ethane (PubChem CID 143889490) has the molecular formula C26H38F2O3 and a molecular weight of 436.58 g/mol. Its IUPAC name is 5-[4-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)oxymethyl]phenyl]-2-pentyloxane;ethane.
| Compound Name | 5-[4-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)oxymethyl]phenyl]-2-pentyloxane;ethane |
|---|---|
| PubChem CID | 143889490 |
| Molecular Formula | C26H38F2O3 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 5-[4-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)oxymethyl]phenyl]-2-pentyloxane;ethane |
| SMILES | CC.CCCCCC1CCC(c2ccc(COC3=C(F)C(F)=C(OC)CC3)cc2)CO1 |
| InChI | InChI=1S/C24H32F2O3.C2H6/c1-3-4-5-6-20-12-11-19(16-28-20)18-9-7-17(8-10-18)15-29-22-14-13-21(27-2)23(25)24(22)26;1-2/h7-10,19-20H,3-6,11-16H2,1-2H3;1-2H3 |
| InChIKey | QGFXYSFEPXHVNU-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|