C24H40F2O3 — CID 143889610
5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]-2-pentyloxane (PubChem CID 143889610) has the molecular formula C24H40F2O3 and a molecular weight of 414.58 g/mol. Its IUPAC name is 5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]-2-pentyloxane.
| Compound Name | 5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]-2-pentyloxane |
|---|---|
| PubChem CID | 143889610 |
| Molecular Formula | C24H40F2O3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)hexan-2-yloxymethyl]-2-pentyloxane |
| SMILES | CCCCCC1CCC(COC(C)CCC(C)C2=C(F)C(F)=C(OC)CC2)CO1 |
| InChI | InChI=1S/C24H40F2O3/c1-5-6-7-8-20-12-11-19(16-29-20)15-28-18(3)10-9-17(2)21-13-14-22(27-4)24(26)23(21)25/h17-20H,5-16H2,1-4H3 |
| InChIKey | UKSOIULGDIDMGK-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|