C21H24ClN5OS — CID 143891024
1-(4-chlorophenyl)-5-methyl-N-[1-[5-(methylaminosulfanyl)-3-pyridinyl]butyl]pyrazole-4-carboxamide (PubChem CID 143891024) has the molecular formula C21H24ClN5OS and a molecular weight of 429.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-N-[1-[5-(methylaminosulfanyl)-3-pyridinyl]butyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-methyl-N-[1-[5-(methylaminosulfanyl)-3-pyridinyl]butyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143891024 |
| Molecular Formula | C21H24ClN5OS |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-N-[1-[5-(methylaminosulfanyl)-3-pyridinyl]butyl]pyrazole-4-carboxamide |
| SMILES | CCCC(NC(=O)c1cnn(-c2ccc(Cl)cc2)c1C)c1cncc(SNC)c1 |
| InChI | InChI=1S/C21H24ClN5OS/c1-4-5-20(15-10-18(29-23-3)12-24-11-15)26-21(28)19-13-25-27(14(19)2)17-8-6-16(22)7-9-17/h6-13,20,23H,4-5H2,1-3H3,(H,26,28) |
| InChIKey | HIPIRZYHRCPVOQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|