C20H21N3S — CID 143891178
1-[5-[5-[(benzylamino)methyl]-2-pyridinyl]thiophen-2-yl]-N-methylethenamine (PubChem CID 143891178) has the molecular formula C20H21N3S and a molecular weight of 335.48 g/mol. Its IUPAC name is 1-[5-[5-[(benzylamino)methyl]-2-pyridinyl]thiophen-2-yl]-N-methylethenamine.
| Compound Name | 1-[5-[5-[(benzylamino)methyl]-2-pyridinyl]thiophen-2-yl]-N-methylethenamine |
|---|---|
| PubChem CID | 143891178 |
| Molecular Formula | C20H21N3S |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[5-[5-[(benzylamino)methyl]-2-pyridinyl]thiophen-2-yl]-N-methylethenamine |
| SMILES | C=C(NC)c1ccc(-c2ccc(CNCc3ccccc3)cn2)s1 |
| InChI | InChI=1S/C20H21N3S/c1-15(21-2)19-10-11-20(24-19)18-9-8-17(14-23-18)13-22-12-16-6-4-3-5-7-16/h3-11,14,21-22H,1,12-13H2,2H3 |
| InChIKey | INJUHXGPJPAXJN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |