C12H15N3 — CID 46784169
N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-phenylmethanamine (PubChem CID 46784169) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-phenylmethanamine.
| Compound Name | N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 46784169 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-[(5-methyl-1H-imidazol-2-yl)methyl]-1-phenylmethanamine |
| SMILES | Cc1cnc(CNCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C12H15N3/c1-10-7-14-12(15-10)9-13-8-11-5-3-2-4-6-11/h2-7,13H,8-9H2,1H3,(H,14,15) |
| InChIKey | NQZHERQAEXDQSA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |