C13H13NO5S — CID 143892120
methyl (2Z,4Z)-2-methyl-3-(3-nitrothiophen-2-yl)oxyhepta-2,4,6-trienoate (PubChem CID 143892120) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is methyl (2Z,4Z)-2-methyl-3-(3-nitrothiophen-2-yl)oxyhepta-2,4,6-trienoate.
| Compound Name | methyl (2Z,4Z)-2-methyl-3-(3-nitrothiophen-2-yl)oxyhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 143892120 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | methyl (2Z,4Z)-2-methyl-3-(3-nitrothiophen-2-yl)oxyhepta-2,4,6-trienoate |
| SMILES | C=C/C=C\C(Oc1sccc1[N+](=O)[O-])=C(/C)C(=O)OC |
| InChI | InChI=1S/C13H13NO5S/c1-4-5-6-11(9(2)12(15)18-3)19-13-10(14(16)17)7-8-20-13/h4-8H,1H2,2-3H3/b6-5-,11-9- |
| InChIKey | MNCBKEOLBFQQBO-AZFXQDNWSA-N |
| XLogP | 3.22 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|