C5H9NO2S — CID 143892384
5-hydroxy-2,3-dimethyl-1,3-thiazolidin-4-one (PubChem CID 143892384) has the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. Its IUPAC name is 5-hydroxy-2,3-dimethyl-1,3-thiazolidin-4-one.
| Compound Name | 5-hydroxy-2,3-dimethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 143892384 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 5-hydroxy-2,3-dimethyl-1,3-thiazolidin-4-one |
| SMILES | CC1SC(O)C(=O)N1C |
| InChI | InChI=1S/C5H9NO2S/c1-3-6(2)4(7)5(8)9-3/h3,5,8H,1-2H3 |
| InChIKey | MVAWXGUPVLAXPH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |