About 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone
2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone (PubChem CID 163723948) has the molecular formula C5H9NO3S
and a molecular weight of 163.20 g/mol. Its IUPAC name is 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone |
| PubChem CID | 163723948 |
| Molecular Formula | C5H9NO3S |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone |
| SMILES | O=C(CO)N1CCS(=O)C1 |
| InChI | InChI=1S/C5H9NO3S/c7-3-5(8)6-1-2-10(9)4-6/h7H,1-4H2 |
| InChIKey | KTZTYQFJMVVILC-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone?
The IUPAC name of 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone (CID 163723948) is 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone.
What is the SMILES notation for 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone?
The canonical SMILES for 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone is O=C(CO)N1CCS(=O)C1.
What is the InChIKey of 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone?
The InChIKey is KTZTYQFJMVVILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3S/c7-3-5(8)6-1-2-10(9)4-6/h7H,1-4H2.
What are the key properties of 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone?
2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone has a molecular weight of 163.20 g/mol, XLogP of -1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-(1-oxo-1,3-thiazolidin-3-yl)ethanone is sourced from PubChem (CID 163723948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).