C18H17NO3S — CID 1438939
ethyl 2-methyl-4-phenacylthieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 1438939) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is ethyl 2-methyl-4-phenacylthieno[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 2-methyl-4-phenacylthieno[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 1438939 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | ethyl 2-methyl-4-phenacylthieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2sc(C)cc2n1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO3S/c1-3-22-18(21)15-10-17-14(9-12(2)23-17)19(15)11-16(20)13-7-5-4-6-8-13/h4-10H,3,11H2,1-2H3 |
| InChIKey | AFOXOANUCHWPTP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |