C21H20N2O4S — CID 1438980
ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylthieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 1438980) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylthieno[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylthieno[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 1438980 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylthieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2sc(C)cc2n1CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20N2O4S/c1-3-27-21(26)17-12-18-16(11-13(2)28-18)22(17)9-6-10-23-19(24)14-7-4-5-8-15(14)20(23)25/h4-5,7-8,11-12H,3,6,9-10H2,1-2H3 |
| InChIKey | DSODBNUHVWRYGD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|