C21H20N2O5 — CID 6487708
ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxylate (PubChem CID 6487708) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 6487708 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | ethyl 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-2-methylfuro[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2oc(C)cc2n1CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H20N2O5/c1-3-27-21(26)17-12-18-16(11-13(2)28-18)22(17)9-6-10-23-19(24)14-7-4-5-8-15(14)20(23)25/h4-5,7-8,11-12H,3,6,9-10H2,1-2H3 |
| InChIKey | VATXZDWPZGVUIX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|