C21H28N4 — CID 143896367
5-[[4-[(4-cyclobutylphenyl)methyl]piperazin-1-yl]methyl]pyridin-2-amine (PubChem CID 143896367) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is 5-[[4-[(4-cyclobutylphenyl)methyl]piperazin-1-yl]methyl]pyridin-2-amine.
| Compound Name | 5-[[4-[(4-cyclobutylphenyl)methyl]piperazin-1-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 143896367 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 5-[[4-[(4-cyclobutylphenyl)methyl]piperazin-1-yl]methyl]pyridin-2-amine |
| SMILES | Nc1ccc(CN2CCN(Cc3ccc(C4CCC4)cc3)CC2)cn1 |
| InChI | InChI=1S/C21H28N4/c22-21-9-6-18(14-23-21)16-25-12-10-24(11-13-25)15-17-4-7-20(8-5-17)19-2-1-3-19/h4-9,14,19H,1-3,10-13,15-16H2,(H2,22,23) |
| InChIKey | UAHICPXZYVDCKA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |