C13H17S+ — CID 143896668
cyclohexa-1,3-dien-1-yl-[(3Z)-hexa-1,3,5-trien-2-yl]-methylsulfanium (PubChem CID 143896668) has the molecular formula C13H17S+ and a molecular weight of 205.35 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl-[(3Z)-hexa-1,3,5-trien-2-yl]-methylsulfanium.
| Compound Name | cyclohexa-1,3-dien-1-yl-[(3Z)-hexa-1,3,5-trien-2-yl]-methylsulfanium |
|---|---|
| PubChem CID | 143896668 |
| Molecular Formula | C13H17S+ |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl-[(3Z)-hexa-1,3,5-trien-2-yl]-methylsulfanium |
| SMILES | C=C/C=C\C(=C)[S+](C)C1=CC=CCC1 |
| InChI | InChI=1S/C13H17S/c1-4-5-9-12(2)14(3)13-10-7-6-8-11-13/h4-7,9-10H,1-2,8,11H2,3H3/q+1/b9-5- |
| InChIKey | VYCFGQXQODBEPH-UITAMQMPSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|