C14H16F4N2O — CID 143897284
2-[3-fluoro-5-(trifluoromethyl)anilino]-1-[(2R)-2-methylpyrrolidin-1-yl]ethanone (PubChem CID 143897284) has the molecular formula C14H16F4N2O and a molecular weight of 304.29 g/mol. Its IUPAC name is 2-[3-fluoro-5-(trifluoromethyl)anilino]-1-[(2R)-2-methylpyrrolidin-1-yl]ethanone.
| Compound Name | 2-[3-fluoro-5-(trifluoromethyl)anilino]-1-[(2R)-2-methylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 143897284 |
| Molecular Formula | C14H16F4N2O |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[3-fluoro-5-(trifluoromethyl)anilino]-1-[(2R)-2-methylpyrrolidin-1-yl]ethanone |
| SMILES | C[C@@H]1CCCN1C(=O)CNc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F4N2O/c1-9-3-2-4-20(9)13(21)8-19-12-6-10(14(16,17)18)5-11(15)7-12/h5-7,9,19H,2-4,8H2,1H3/t9-/m1/s1 |
| InChIKey | SLRLIOMHOKZFCP-SECBINFHSA-N |
| XLogP | 3.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |