C21H25ClN2OS — CID 143897716
but-1-ene;2-(4-chloro-7-methoxy-8-methylquinolin-2-yl)-4-propan-2-yl-1,3-thiazole (PubChem CID 143897716) has the molecular formula C21H25ClN2OS and a molecular weight of 388.96 g/mol. Its IUPAC name is but-1-ene;2-(4-chloro-7-methoxy-8-methylquinolin-2-yl)-4-propan-2-yl-1,3-thiazole.
| Compound Name | but-1-ene;2-(4-chloro-7-methoxy-8-methylquinolin-2-yl)-4-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 143897716 |
| Molecular Formula | C21H25ClN2OS |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | but-1-ene;2-(4-chloro-7-methoxy-8-methylquinolin-2-yl)-4-propan-2-yl-1,3-thiazole |
| SMILES | C=CCC.COc1ccc2c(Cl)cc(-c3nc(C(C)C)cs3)nc2c1C |
| InChI | InChI=1S/C17H17ClN2OS.C4H8/c1-9(2)14-8-22-17(20-14)13-7-12(18)11-5-6-15(21-4)10(3)16(11)19-13;1-3-4-2/h5-9H,1-4H3;3H,1,4H2,2H3 |
| InChIKey | MPUVSZGOLDQSDR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|