C33H43N3O5S — CID 91506360
methyl 2-[2-[hex-5-enyl(methyl)carbamoyl]-4-[7-methoxy-8-methyl-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxycyclopentyl]acetate (PubChem CID 91506360) has the molecular formula C33H43N3O5S and a molecular weight of 593.79 g/mol. Its IUPAC name is methyl 2-[2-[hex-5-enyl(methyl)carbamoyl]-4-[7-methoxy-8-methyl-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxycyclopentyl]acetate.
| Compound Name | methyl 2-[2-[hex-5-enyl(methyl)carbamoyl]-4-[7-methoxy-8-methyl-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxycyclopentyl]acetate |
|---|---|
| PubChem CID | 91506360 |
| Molecular Formula | C33H43N3O5S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | methyl 2-[2-[hex-5-enyl(methyl)carbamoyl]-4-[7-methoxy-8-methyl-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxycyclopentyl]acetate |
| SMILES | C=CCCCCN(C)C(=O)C1CC(Oc2cc(-c3nc(C(C)C)cs3)nc3c(C)c(OC)ccc23)CC1CC(=O)OC |
| InChI | InChI=1S/C33H43N3O5S/c1-8-9-10-11-14-36(5)33(38)25-17-23(15-22(25)16-30(37)40-7)41-29-18-26(32-35-27(19-42-32)20(2)3)34-31-21(4)28(39-6)13-12-24(29)31/h8,12-13,18-20,22-23,25H,1,9-11,14-17H2,2-7H3 |
| InChIKey | QZEDMLBQZXKMHD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|