C34H45N3O4S — CID 143401502
(1R,2R,4R)-2-N-hex-5-enyl-4-[[(5E,7Z)-2-methoxy-8-methyl-7-(4-propan-2-yl-1,3-thiazol-2-yl)-9,10-dihydrobenzo[8]annulen-5-yl]oxy]-2-N-methylcyclopentane-1,2-dicarboxamide (PubChem CID 143401502) has the molecular formula C34H45N3O4S and a molecular weight of 591.82 g/mol. Its IUPAC name is (1R,2R,4R)-2-N-hex-5-enyl-4-[[(5E,7Z)-2-methoxy-8-methyl-7-(4-propan-2-yl-1,3-thiazol-2-yl)-9,10-dihydrobenzo[8]annulen-5-yl]oxy]-2-N-methylcyclopentane-1,2-dicarboxamide.
| Compound Name | (1R,2R,4R)-2-N-hex-5-enyl-4-[[(5E,7Z)-2-methoxy-8-methyl-7-(4-propan-2-yl-1,3-thiazol-2-yl)-9,10-dihydrobenzo[8]annulen-5-yl]oxy]-2-N-methylcyclopentane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 143401502 |
| Molecular Formula | C34H45N3O4S |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | (1R,2R,4R)-2-N-hex-5-enyl-4-[[(5E,7Z)-2-methoxy-8-methyl-7-(4-propan-2-yl-1,3-thiazol-2-yl)-9,10-dihydrobenzo[8]annulen-5-yl]oxy]-2-N-methylcyclopentane-1,2-dicarboxamide |
| SMILES | C=CCCCCN(C)C(=O)[C@@H]1C[C@H](O/C2=C/C(c3nc(C(C)C)cs3)=C(/C)CCc3cc(OC)ccc32)C[C@H]1C(N)=O |
| InChI | InChI=1S/C34H45N3O4S/c1-7-8-9-10-15-37(5)34(39)29-18-25(17-28(29)32(35)38)41-31-19-27(33-36-30(20-42-33)21(2)3)22(4)11-12-23-16-24(40-6)13-14-26(23)31/h7,13-14,16,19-21,25,28-29H,1,8-12,15,17-18H2,2-6H3,(H2,35,38)/b27-22+,31-19+/t25-,28-,29-/m1/s1 |
| InChIKey | YNEGVQYXTWRXLF-BZEITVIMSA-N |
| XLogP | 6.75 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|