C37H44FN5O6S — CID 143898062
(1R,4S,6R,10S)-N-cyclopropylsulfonyl-10-(3-fluoroanilino)-6-isoquinolin-1-yloxy-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide (PubChem CID 143898062) has the molecular formula C37H44FN5O6S and a molecular weight of 705.85 g/mol. Its IUPAC name is (1R,4S,6R,10S)-N-cyclopropylsulfonyl-10-(3-fluoroanilino)-6-isoquinolin-1-yloxy-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide.
| Compound Name | (1R,4S,6R,10S)-N-cyclopropylsulfonyl-10-(3-fluoroanilino)-6-isoquinolin-1-yloxy-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide |
|---|---|
| PubChem CID | 143898062 |
| Molecular Formula | C37H44FN5O6S |
| Molecular Weight | 705.85 g/mol |
| Exact Mass | 705.30 |
| IUPAC Name | (1R,4S,6R,10S)-N-cyclopropylsulfonyl-10-(3-fluoroanilino)-6-isoquinolin-1-yloxy-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide |
| SMILES | O=C1N[C@]2(C(=O)NS(=O)(=O)C3CC3)CCC(CCCCCC[C@H](Nc3cccc(F)c3)C(=O)N3C[C@H](Oc4nccc5ccccc45)C[C@@H]13)C2 |
| InChI | InChI=1S/C37H44FN5O6S/c38-26-10-7-11-27(20-26)40-31-13-4-2-1-3-8-24-16-18-37(22-24,36(46)42-50(47,48)29-14-15-29)41-33(44)32-21-28(23-43(32)35(31)45)49-34-30-12-6-5-9-25(30)17-19-39-34/h5-7,9-12,17,19-20,24,28-29,31-32,40H,1-4,8,13-16,18,21-23H2,(H,41,44)(H,42,46)/t24?,28-,31+,32+,37-/m1/s1 |
| InChIKey | KRBMKJKKUIKPKI-SJXZMWTKSA-N |
| XLogP | 4.82 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |