C34H45N5O7S2 — CID 143897364
(1R,4S,6R,10S)-N-cyclopropylsulfonyl-6-[(4-ethenyl-1,3-thiazol-2-yl)oxy]-10-(3-methoxyanilino)-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide (PubChem CID 143897364) has the molecular formula C34H45N5O7S2 and a molecular weight of 699.90 g/mol. Its IUPAC name is (1R,4S,6R,10S)-N-cyclopropylsulfonyl-6-[(4-ethenyl-1,3-thiazol-2-yl)oxy]-10-(3-methoxyanilino)-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide.
| Compound Name | (1R,4S,6R,10S)-N-cyclopropylsulfonyl-6-[(4-ethenyl-1,3-thiazol-2-yl)oxy]-10-(3-methoxyanilino)-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide |
|---|---|
| PubChem CID | 143897364 |
| Molecular Formula | C34H45N5O7S2 |
| Molecular Weight | 699.90 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | (1R,4S,6R,10S)-N-cyclopropylsulfonyl-6-[(4-ethenyl-1,3-thiazol-2-yl)oxy]-10-(3-methoxyanilino)-3,9-dioxo-2,8-diazatricyclo[15.2.1.04,8]icosane-1-carboxamide |
| SMILES | C=Cc1csc(O[C@@H]2C[C@H]3C(=O)N[C@]4(C(=O)NS(=O)(=O)C5CC5)CCC(CCCCCC[C@H](Nc5cccc(OC)c5)C(=O)N3C2)C4)n1 |
| InChI | InChI=1S/C34H45N5O7S2/c1-3-23-21-47-33(36-23)46-26-18-29-30(40)37-34(32(42)38-48(43,44)27-13-14-27)16-15-22(19-34)9-6-4-5-7-12-28(31(41)39(29)20-26)35-24-10-8-11-25(17-24)45-2/h3,8,10-11,17,21-22,26-29,35H,1,4-7,9,12-16,18-20H2,2H3,(H,37,40)(H,38,42)/t22?,26-,28+,29+,34-/m1/s1 |
| InChIKey | IIDDTBPMRDNSSK-QNOOQTBMSA-N |
| XLogP | 4.24 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |