C32H38BN5O8S — CID 90914540
CID 90914540 (PubChem CID 90914540) has the molecular formula C32H38BN5O8S and a molecular weight of 663.56 g/mol.
| Compound Name | CID 90914540 |
|---|---|
| PubChem CID | 90914540 |
| Molecular Formula | C32H38BN5O8S |
| Molecular Weight | 663.56 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@H]1CCCCCC=CC2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2C[C@@H](Oc3ccnc4cc(OC)ccc34)CN2C1=O |
| InChI | InChI=1S/C32H38BN5O8S/c1-45-20-9-12-23-25(15-20)34-14-13-27(23)46-21-16-26-28(39)36-32(30(41)37-47(43,44)22-10-11-22)17-19(32)7-5-3-2-4-6-8-24(35-31(33)42)29(40)38(26)18-21/h5,7,9,12-15,19,21-22,24,26H,2-4,6,8,10-11,16-18H2,1H3,(H,35,42)(H,36,39)(H,37,41)/t19?,21-,24-,26+,32-/m1/s1 |
| InChIKey | CTYMQSMNXAZCBN-KYALWGHVSA-N |
| XLogP | 1.84 |
| TPSA | 173.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|