C38H42BN5O8S — CID 59990358
CID 59990358 (PubChem CID 59990358) has the molecular formula C38H42BN5O8S and a molecular weight of 739.66 g/mol.
| Compound Name | CID 59990358 |
|---|---|
| PubChem CID | 59990358 |
| Molecular Formula | C38H42BN5O8S |
| Molecular Weight | 739.66 g/mol |
| Exact Mass | 739.28 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H]1CCCCC/C=C\C2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2C[C@@H](Oc3cc(-c4ccccc4)nc4cc(OC)ccc34)CN2C1=O |
| InChI | InChI=1S/C38H42BN5O8S/c1-51-25-14-17-28-31(18-25)40-30(23-10-6-5-7-11-23)20-33(28)52-26-19-32-34(45)42-38(36(47)43-53(49,50)27-15-16-27)21-24(38)12-8-3-2-4-9-13-29(41-37(39)48)35(46)44(32)22-26/h5-8,10-12,14,17-18,20,24,26-27,29,32H,2-4,9,13,15-16,19,21-22H2,1H3,(H,41,48)(H,42,45)(H,43,47)/b12-8-/t24?,26-,29+,32+,38-/m1/s1 |
| InChIKey | FBCUVXWRULLIDW-QYAVXTKASA-N |
| XLogP | 3.51 |
| TPSA | 173.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|