C22H25BrN4O2 — CID 143898772
2-[C-[(Z)-3-(3-bromophenyl)-2-hydroxybut-2-enyl]-N-methylcarbonimidoyl]-3H-benzimidazole-5-carboxamide;ethane (PubChem CID 143898772) has the molecular formula C22H25BrN4O2 and a molecular weight of 457.37 g/mol. Its IUPAC name is 2-[C-[(Z)-3-(3-bromophenyl)-2-hydroxybut-2-enyl]-N-methylcarbonimidoyl]-3H-benzimidazole-5-carboxamide;ethane.
| Compound Name | 2-[C-[(Z)-3-(3-bromophenyl)-2-hydroxybut-2-enyl]-N-methylcarbonimidoyl]-3H-benzimidazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 143898772 |
| Molecular Formula | C22H25BrN4O2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 2-[C-[(Z)-3-(3-bromophenyl)-2-hydroxybut-2-enyl]-N-methylcarbonimidoyl]-3H-benzimidazole-5-carboxamide;ethane |
| SMILES | C/N=C(\C/C(O)=C(\C)c1cccc(Br)c1)c1nc2ccc(C(N)=O)cc2[nH]1.CC |
| InChI | InChI=1S/C20H19BrN4O2.C2H6/c1-11(12-4-3-5-14(21)8-12)18(26)10-17(23-2)20-24-15-7-6-13(19(22)27)9-16(15)25-20;1-2/h3-9,26H,10H2,1-2H3,(H2,22,27)(H,24,25);1-2H3/b18-11-,23-17+; |
| InChIKey | JGVQNTHQQLEDKM-SRJITGPXSA-N |
| XLogP | 5.25 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|