C39H43B2ClN4O4 — CID 143900711
2-(4-chlorophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine;2-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 143900711) has the molecular formula C39H43B2ClN4O4 and a molecular weight of 688.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine;2-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(4-chlorophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine;2-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 143900711 |
| Molecular Formula | C39H43B2ClN4O4 |
| Molecular Weight | 688.87 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | 2-(4-chlorophenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine;2-(4-methylphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | CC1(C)OB(c2ccc3nc(-c4ccc(Cl)cc4)cn3c2)OC1(C)C.Cc1ccc(-c2cn3cc(B4OC(C)(C)C(C)(C)O4)ccc3n2)cc1 |
| InChI | InChI=1S/C20H23BN2O2.C19H20BClN2O2/c1-14-6-8-15(9-7-14)17-13-23-12-16(10-11-18(23)22-17)21-24-19(2,3)20(4,5)25-21;1-18(2)19(3,4)25-20(24-18)14-7-10-17-22-16(12-23(17)11-14)13-5-8-15(21)9-6-13/h6-13H,1-5H3;5-12H,1-4H3 |
| InChIKey | FBKQSPZPEMVFOU-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.87 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|