C10H17NO2S — CID 143902900
methyl 1-methyl-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate (PubChem CID 143902900) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is methyl 1-methyl-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate.
| Compound Name | methyl 1-methyl-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143902900 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | methyl 1-methyl-4-prop-2-enylsulfanylpyrrolidine-2-carboxylate |
| SMILES | C=CCSC1CC(C(=O)OC)N(C)C1 |
| InChI | InChI=1S/C10H17NO2S/c1-4-5-14-8-6-9(10(12)13-3)11(2)7-8/h4,8-9H,1,5-7H2,2-3H3 |
| InChIKey | KITWNBPVCLATOK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|