C23H22F3N5O2S — CID 143902951
[[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]methanol (PubChem CID 143902951) has the molecular formula C23H22F3N5O2S and a molecular weight of 489.52 g/mol. Its IUPAC name is [[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]methanol.
| Compound Name | [[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]methanol |
|---|---|
| PubChem CID | 143902951 |
| Molecular Formula | C23H22F3N5O2S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [[5-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]amino]-[2-[3-(trifluoromethyl)phenyl]imidazo[1,2-a]pyridin-8-yl]methanol |
| SMILES | OC(Nc1ncc(CN2CCOCC2)s1)c1cccn2cc(-c3cccc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C23H22F3N5O2S/c24-23(25,26)16-4-1-3-15(11-16)19-14-31-6-2-5-18(20(31)28-19)21(32)29-22-27-12-17(34-22)13-30-7-9-33-10-8-30/h1-6,11-12,14,21,32H,7-10,13H2,(H,27,29) |
| InChIKey | QKHPEOOLXQRCQE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|