C17H33N3O — CID 143903152
2-(cyclohexylmethylamino)-N-(3-ethylpent-1-yn-3-yl)acetamide;methanamine (PubChem CID 143903152) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-(cyclohexylmethylamino)-N-(3-ethylpent-1-yn-3-yl)acetamide;methanamine.
| Compound Name | 2-(cyclohexylmethylamino)-N-(3-ethylpent-1-yn-3-yl)acetamide;methanamine |
|---|---|
| PubChem CID | 143903152 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 2-(cyclohexylmethylamino)-N-(3-ethylpent-1-yn-3-yl)acetamide;methanamine |
| SMILES | C#CC(CC)(CC)NC(=O)CNCC1CCCCC1.CN |
| InChI | InChI=1S/C16H28N2O.CH5N/c1-4-16(5-2,6-3)18-15(19)13-17-12-14-10-8-7-9-11-14;1-2/h1,14,17H,5-13H2,2-3H3,(H,18,19);2H2,1H3 |
| InChIKey | NYPROYJTDYFFJE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|