C12H21N3O — CID 65249512
2-(3-aminoazetidin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide (PubChem CID 65249512) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(3-aminoazetidin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide.
| Compound Name | 2-(3-aminoazetidin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide |
|---|---|
| PubChem CID | 65249512 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(3-aminoazetidin-1-yl)-N-(3-ethylpent-1-yn-3-yl)acetamide |
| SMILES | C#CC(CC)(CC)NC(=O)CN1CC(N)C1 |
| InChI | InChI=1S/C12H21N3O/c1-4-12(5-2,6-3)14-11(16)9-15-7-10(13)8-15/h1,10H,5-9,13H2,2-3H3,(H,14,16) |
| InChIKey | RKSOXBBNGKWMOX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|