C31H43F6NO2 — CID 143903232
7-[4-[4-[3,5-bis(trifluoromethyl)phenyl]-4-oxobutyl]cyclohexyl]-1-(1-methylpiperidin-3-yl)heptan-1-one (PubChem CID 143903232) has the molecular formula C31H43F6NO2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 7-[4-[4-[3,5-bis(trifluoromethyl)phenyl]-4-oxobutyl]cyclohexyl]-1-(1-methylpiperidin-3-yl)heptan-1-one.
| Compound Name | 7-[4-[4-[3,5-bis(trifluoromethyl)phenyl]-4-oxobutyl]cyclohexyl]-1-(1-methylpiperidin-3-yl)heptan-1-one |
|---|---|
| PubChem CID | 143903232 |
| Molecular Formula | C31H43F6NO2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | 7-[4-[4-[3,5-bis(trifluoromethyl)phenyl]-4-oxobutyl]cyclohexyl]-1-(1-methylpiperidin-3-yl)heptan-1-one |
| SMILES | CN1CCCC(C(=O)CCCCCCC2CCC(CCCC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C31H43F6NO2/c1-38-17-7-10-24(21-38)28(39)11-5-3-2-4-8-22-13-15-23(16-14-22)9-6-12-29(40)25-18-26(30(32,33)34)20-27(19-25)31(35,36)37/h18-20,22-24H,2-17,21H2,1H3 |
| InChIKey | DMILGQKROZSFMU-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|