About [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate
[4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate (PubChem CID 143903360) has the molecular formula C16H15N3O5
and a molecular weight of 329.31 g/mol. Its IUPAC name is [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate.
Molecular Properties
| Compound Name | [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate |
| PubChem CID | 143903360 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate |
| SMILES | N#COc1c(C(=O)NOCc2ccccc2)ncc(CO)c1CO |
| InChI | InChI=1S/C16H15N3O5/c17-10-23-15-13(8-21)12(7-20)6-18-14(15)16(22)19-24-9-11-4-2-1-3-5-11/h1-6,20-21H,7-9H2,(H,19,22) |
| InChIKey | HZSOVKDJLSBYCV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate?
The IUPAC name of [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate (CID 143903360) is [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate.
What is the SMILES notation for [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate?
The canonical SMILES for [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate is N#COc1c(C(=O)NOCc2ccccc2)ncc(CO)c1CO.
What is the InChIKey of [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate?
The InChIKey is HZSOVKDJLSBYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O5/c17-10-23-15-13(8-21)12(7-20)6-18-14(15)16(22)19-24-9-11-4-2-1-3-5-11/h1-6,20-21H,7-9H2,(H,19,22).
What are the key properties of [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate?
[4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate has a molecular weight of 329.31 g/mol, XLogP of 0.79, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-bis(hydroxymethyl)-2-(phenylmethoxycarbamoyl)-3-pyridinyl] cyanate is sourced from PubChem (CID 143903360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).